C18H26N2O3 — CID 103393492
benzyl N-[3-[(1-hydroxycyclopentyl)methylamino]cyclobutyl]carbamate (PubChem CID 103393492) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is benzyl N-[3-[(1-hydroxycyclopentyl)methylamino]cyclobutyl]carbamate.
| Compound Name | benzyl N-[3-[(1-hydroxycyclopentyl)methylamino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 103393492 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | benzyl N-[3-[(1-hydroxycyclopentyl)methylamino]cyclobutyl]carbamate |
| SMILES | O=C(NC1CC(NCC2(O)CCCC2)C1)OCc1ccccc1 |
| InChI | InChI=1S/C18H26N2O3/c21-17(23-12-14-6-2-1-3-7-14)20-16-10-15(11-16)19-13-18(22)8-4-5-9-18/h1-3,6-7,15-16,19,22H,4-5,8-13H2,(H,20,21) |
| InChIKey | JBHUTBKUBUDPEP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |