C18H26N2O2S — CID 103393578
benzyl N-[3-(thian-2-ylmethylamino)cyclobutyl]carbamate (PubChem CID 103393578) has the molecular formula C18H26N2O2S and a molecular weight of 334.48 g/mol. Its IUPAC name is benzyl N-[3-(thian-2-ylmethylamino)cyclobutyl]carbamate.
| Compound Name | benzyl N-[3-(thian-2-ylmethylamino)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 103393578 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | benzyl N-[3-(thian-2-ylmethylamino)cyclobutyl]carbamate |
| SMILES | O=C(NC1CC(NCC2CCCCS2)C1)OCc1ccccc1 |
| InChI | InChI=1S/C18H26N2O2S/c21-18(22-13-14-6-2-1-3-7-14)20-16-10-15(11-16)19-12-17-8-4-5-9-23-17/h1-3,6-7,15-17,19H,4-5,8-13H2,(H,20,21) |
| InChIKey | BOLYBKFNEZJHJG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |