C15H17NO3S — CID 24819532
1-(benzenesulfonyl)-N-prop-2-enylcyclopent-3-ene-1-carboxamide (PubChem CID 24819532) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-prop-2-enylcyclopent-3-ene-1-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-prop-2-enylcyclopent-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 24819532 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 1-(benzenesulfonyl)-N-prop-2-enylcyclopent-3-ene-1-carboxamide |
| SMILES | C=CCNC(=O)C1(S(=O)(=O)c2ccccc2)CC=CC1 |
| InChI | InChI=1S/C15H17NO3S/c1-2-12-16-14(17)15(10-6-7-11-15)20(18,19)13-8-4-3-5-9-13/h2-9H,1,10-12H2,(H,16,17) |
| InChIKey | YGBUBRYQFHOXAZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|