C22H34O6Si — CID 10070898
methyl (1R,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-(phenylmethoxymethoxy)cyclohex-2-ene-1-carboxylate (PubChem CID 10070898) has the molecular formula C22H34O6Si and a molecular weight of 422.59 g/mol. Its IUPAC name is methyl (1R,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-(phenylmethoxymethoxy)cyclohex-2-ene-1-carboxylate.
| Compound Name | methyl (1R,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-(phenylmethoxymethoxy)cyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 10070898 |
| Molecular Formula | C22H34O6Si |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | methyl (1R,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-(phenylmethoxymethoxy)cyclohex-2-ene-1-carboxylate |
| SMILES | COC(=O)[C@]1(O[Si](C)(C)C(C)(C)C)C=C[C@@H](O)[C@H](OCOCc2ccccc2)C1 |
| InChI | InChI=1S/C22H34O6Si/c1-21(2,3)29(5,6)28-22(20(24)25-4)13-12-18(23)19(14-22)27-16-26-15-17-10-8-7-9-11-17/h7-13,18-19,23H,14-16H2,1-6H3/t18-,19-,22+/m1/s1 |
| InChIKey | NMBOPDZEFFINAY-KNKQGSTJSA-N |
| XLogP | 3.80 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|