C29H38O7Si — CID 10007095
[(1R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-4-methoxycarbonyl-6-(phenylmethoxymethoxy)cyclohex-2-en-1-yl] benzoate (PubChem CID 10007095) has the molecular formula C29H38O7Si and a molecular weight of 526.70 g/mol. Its IUPAC name is [(1R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-4-methoxycarbonyl-6-(phenylmethoxymethoxy)cyclohex-2-en-1-yl] benzoate.
| Compound Name | [(1R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-4-methoxycarbonyl-6-(phenylmethoxymethoxy)cyclohex-2-en-1-yl] benzoate |
|---|---|
| PubChem CID | 10007095 |
| Molecular Formula | C29H38O7Si |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | [(1R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-4-methoxycarbonyl-6-(phenylmethoxymethoxy)cyclohex-2-en-1-yl] benzoate |
| SMILES | COC(=O)[C@]1(O[Si](C)(C)C(C)(C)C)C=C[C@@H](OC(=O)c2ccccc2)[C@H](OCOCc2ccccc2)C1 |
| InChI | InChI=1S/C29H38O7Si/c1-28(2,3)37(5,6)36-29(27(31)32-4)18-17-24(35-26(30)23-15-11-8-12-16-23)25(19-29)34-21-33-20-22-13-9-7-10-14-22/h7-18,24-25H,19-21H2,1-6H3/t24-,25-,29+/m1/s1 |
| InChIKey | FNQAZGYDTRMLKB-MIHVYDCKSA-N |
| XLogP | 5.66 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|