C23H34O5Si — CID 11270063
(1R,5S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(phenylmethoxymethoxymethyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 11270063) has the molecular formula C23H34O5Si and a molecular weight of 418.61 g/mol. Its IUPAC name is (1R,5S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(phenylmethoxymethoxymethyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,5S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(phenylmethoxymethoxymethyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 11270063 |
| Molecular Formula | C23H34O5Si |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | (1R,5S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(phenylmethoxymethoxymethyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]12C=C[C@](COCOCc3ccccc3)(CC(=O)C1)O2 |
| InChI | InChI=1S/C23H34O5Si/c1-21(2,3)29(4,5)27-17-23-12-11-22(28-23,13-20(24)14-23)16-26-18-25-15-19-9-7-6-8-10-19/h6-12H,13-18H2,1-5H3/t22-,23+/m1/s1 |
| InChIKey | WPLOFKJLHVBIDV-PKTZIBPZSA-N |
| XLogP | 4.63 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|