C24H34O5Si — CID 101140422
(1R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methylidene-1-(phenylmethoxymethoxymethyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 101140422) has the molecular formula C24H34O5Si and a molecular weight of 430.62 g/mol. Its IUPAC name is (1R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methylidene-1-(phenylmethoxymethoxymethyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methylidene-1-(phenylmethoxymethoxymethyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 101140422 |
| Molecular Formula | C24H34O5Si |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (1R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methylidene-1-(phenylmethoxymethoxymethyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | C=C1C(=O)C[C@]2(CO[Si](C)(C)C(C)(C)C)C=C[C@@]1(COCOCc1ccccc1)O2 |
| InChI | InChI=1S/C24H34O5Si/c1-19-21(25)14-23(16-28-30(5,6)22(2,3)4)12-13-24(19,29-23)17-27-18-26-15-20-10-8-7-9-11-20/h7-13H,1,14-18H2,2-6H3/t23-,24-/m0/s1 |
| InChIKey | ZCTDFMQVCOZGOP-ZEQRLZLVSA-N |
| XLogP | 4.79 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|