C17H31NO7S2 — CID 11845546
1-[(2S,3R,4R,5R)-2-(1,3-dithian-2-yl)-3,4,5-tris(methoxymethoxy)piperidin-1-yl]ethanone (PubChem CID 11845546) has the molecular formula C17H31NO7S2 and a molecular weight of 425.57 g/mol. Its IUPAC name is 1-[(2S,3R,4R,5R)-2-(1,3-dithian-2-yl)-3,4,5-tris(methoxymethoxy)piperidin-1-yl]ethanone.
| Compound Name | 1-[(2S,3R,4R,5R)-2-(1,3-dithian-2-yl)-3,4,5-tris(methoxymethoxy)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 11845546 |
| Molecular Formula | C17H31NO7S2 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 1-[(2S,3R,4R,5R)-2-(1,3-dithian-2-yl)-3,4,5-tris(methoxymethoxy)piperidin-1-yl]ethanone |
| SMILES | COCO[C@H]1[C@H](OCOC)[C@H](OCOC)CN(C(C)=O)[C@@H]1C1SCCCS1 |
| InChI | InChI=1S/C17H31NO7S2/c1-12(19)18-8-13(23-9-20-2)15(24-10-21-3)16(25-11-22-4)14(18)17-26-6-5-7-27-17/h13-17H,5-11H2,1-4H3/t13-,14+,15-,16-/m1/s1 |
| InChIKey | RNKUKEITLKNCIS-QKPAOTATSA-N |
| XLogP | 1.38 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|