C12H21FO6 — CID 155663670
[(1R,2S,3R,4R)-2-fluoro-3-(methoxymethoxy)-4-(methoxymethoxymethyl)cyclopentyl] acetate (PubChem CID 155663670) has the molecular formula C12H21FO6 and a molecular weight of 280.29 g/mol. Its IUPAC name is [(1R,2S,3R,4R)-2-fluoro-3-(methoxymethoxy)-4-(methoxymethoxymethyl)cyclopentyl] acetate.
| Compound Name | [(1R,2S,3R,4R)-2-fluoro-3-(methoxymethoxy)-4-(methoxymethoxymethyl)cyclopentyl] acetate |
|---|---|
| PubChem CID | 155663670 |
| Molecular Formula | C12H21FO6 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | [(1R,2S,3R,4R)-2-fluoro-3-(methoxymethoxy)-4-(methoxymethoxymethyl)cyclopentyl] acetate |
| SMILES | COCOC[C@H]1C[C@@H](OC(C)=O)[C@H](F)[C@@H]1OCOC |
| InChI | InChI=1S/C12H21FO6/c1-8(14)19-10-4-9(5-17-6-15-2)12(11(10)13)18-7-16-3/h9-12H,4-7H2,1-3H3/t9-,10-,11+,12-/m1/s1 |
| InChIKey | CJNOGLCNBDVQME-WISYIIOYSA-N |
| XLogP | 0.89 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|