C12H21NO6 — CID 10826236
(1S,2S,7S,8aS)-7-hydroxy-1,2-bis(methoxymethoxy)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 10826236) has the molecular formula C12H21NO6 and a molecular weight of 275.30 g/mol. Its IUPAC name is (1S,2S,7S,8aS)-7-hydroxy-1,2-bis(methoxymethoxy)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (1S,2S,7S,8aS)-7-hydroxy-1,2-bis(methoxymethoxy)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 10826236 |
| Molecular Formula | C12H21NO6 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | (1S,2S,7S,8aS)-7-hydroxy-1,2-bis(methoxymethoxy)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | COCO[C@@H]1[C@@H](OCOC)CN2C(=O)C[C@@H](O)C[C@@H]12 |
| InChI | InChI=1S/C12H21NO6/c1-16-6-18-10-5-13-9(12(10)19-7-17-2)3-8(14)4-11(13)15/h8-10,12,14H,3-7H2,1-2H3/t8-,9-,10-,12-/m0/s1 |
| InChIKey | XGNZRAMBEQAYDU-GMOBBJLQSA-N |
| XLogP | -0.67 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|