C19H32O5Si — CID 71770386
(1R,2S,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-2-methyl-7-methylidenebicyclo[3.2.0]heptane-6,6-dicarbaldehyde (PubChem CID 71770386) has the molecular formula C19H32O5Si and a molecular weight of 368.55 g/mol. Its IUPAC name is (1R,2S,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-2-methyl-7-methylidenebicyclo[3.2.0]heptane-6,6-dicarbaldehyde.
| Compound Name | (1R,2S,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-2-methyl-7-methylidenebicyclo[3.2.0]heptane-6,6-dicarbaldehyde |
|---|---|
| PubChem CID | 71770386 |
| Molecular Formula | C19H32O5Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (1R,2S,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-2-methyl-7-methylidenebicyclo[3.2.0]heptane-6,6-dicarbaldehyde |
| SMILES | C=C1[C@H]2[C@H]([C@@H](OCOC)C[C@]2(C)O[Si](C)(C)C(C)(C)C)C1(C=O)C=O |
| InChI | InChI=1S/C19H32O5Si/c1-13-15-16(19(13,10-20)11-21)14(23-12-22-6)9-18(15,5)24-25(7,8)17(2,3)4/h10-11,14-16H,1,9,12H2,2-8H3/t14-,15-,16-,18-/m0/s1 |
| InChIKey | BZAXEYQAOODKFG-OVWQWFNUSA-N |
| XLogP | 3.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|