C28H48O5Si — CID 102362436
(1R,2'R,5S,6S,7S,9S)-2'-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(methoxymethoxy)-3',3'-dimethyl-10-methylidenespiro[3-oxatricyclo[7.2.1.01,6]dodecane-5,1'-cyclohexane]-2-one (PubChem CID 102362436) has the molecular formula C28H48O5Si and a molecular weight of 492.77 g/mol. Its IUPAC name is (1R,2'R,5S,6S,7S,9S)-2'-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(methoxymethoxy)-3',3'-dimethyl-10-methylidenespiro[3-oxatricyclo[7.2.1.01,6]dodecane-5,1'-cyclohexane]-2-one.
| Compound Name | (1R,2'R,5S,6S,7S,9S)-2'-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(methoxymethoxy)-3',3'-dimethyl-10-methylidenespiro[3-oxatricyclo[7.2.1.01,6]dodecane-5,1'-cyclohexane]-2-one |
|---|---|
| PubChem CID | 102362436 |
| Molecular Formula | C28H48O5Si |
| Molecular Weight | 492.77 g/mol |
| Exact Mass | 492.33 |
| IUPAC Name | (1R,2'R,5S,6S,7S,9S)-2'-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(methoxymethoxy)-3',3'-dimethyl-10-methylidenespiro[3-oxatricyclo[7.2.1.01,6]dodecane-5,1'-cyclohexane]-2-one |
| SMILES | C=C1C[C@]23C[C@H]1C[C@H](OCOC)[C@H]2[C@@]1(CCCC(C)(C)[C@H]1CO[Si](C)(C)C(C)(C)C)COC3=O |
| InChI | InChI=1S/C28H48O5Si/c1-19-14-28-15-20(19)13-21(32-18-30-7)23(28)27(17-31-24(28)29)12-10-11-26(5,6)22(27)16-33-34(8,9)25(2,3)4/h20-23H,1,10-18H2,2-9H3/t20-,21+,22-,23+,27+,28+/m1/s1 |
| InChIKey | RPCVFJYYPOEEQQ-CUWXCGENSA-N |
| XLogP | 6.34 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.77 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|