C29H54O5SSi — CID 59439223
(2R,4R,7R,9R,14R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfanyl]-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one (PubChem CID 59439223) has the molecular formula C29H54O5SSi and a molecular weight of 542.90 g/mol. Its IUPAC name is (2R,4R,7R,9R,14R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfanyl]-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one.
| Compound Name | (2R,4R,7R,9R,14R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfanyl]-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one |
|---|---|
| PubChem CID | 59439223 |
| Molecular Formula | C29H54O5SSi |
| Molecular Weight | 542.90 g/mol |
| Exact Mass | 542.35 |
| IUPAC Name | (2R,4R,7R,9R,14R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfanyl]-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one |
| SMILES | COCOC1C[C@@](C)(SCCO[Si](C)(C)C(C)(C)C)C(=O)[C@H](C)C23CCC(OC)C2[C@@]1(C)[C@H](C)CC3 |
| InChI | InChI=1S/C29H54O5SSi/c1-20-12-14-29-15-13-22(32-9)24(29)28(20,7)23(33-19-31-8)18-27(6,25(30)21(29)2)35-17-16-34-36(10,11)26(3,4)5/h20-24H,12-19H2,1-11H3/t20-,21+,22?,23?,24?,27-,28+,29?/m1/s1 |
| InChIKey | MOCPWGVGRPECDL-CDXCEZMJSA-N |
| XLogP | 6.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.90 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|