C25H42O4 — CID 158295540
(2R,4R,6R,7R,14R)-4-[(E)-but-2-enyl]-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one (PubChem CID 158295540) has the molecular formula C25H42O4 and a molecular weight of 406.61 g/mol. Its IUPAC name is (2R,4R,6R,7R,14R)-4-[(E)-but-2-enyl]-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one.
| Compound Name | (2R,4R,6R,7R,14R)-4-[(E)-but-2-enyl]-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one |
|---|---|
| PubChem CID | 158295540 |
| Molecular Formula | C25H42O4 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | (2R,4R,6R,7R,14R)-4-[(E)-but-2-enyl]-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one |
| SMILES | C/C=C/C[C@]1(C)C[C@@H](OCOC)[C@@]2(C)C3C(OC)CCC3(CC[C@H]2C)[C@@H](C)C1=O |
| InChI | InChI=1S/C25H42O4/c1-8-9-12-23(4)15-20(29-16-27-6)24(5)17(2)10-13-25(18(3)22(23)26)14-11-19(28-7)21(24)25/h8-9,17-21H,10-16H2,1-7H3/b9-8+/t17-,18+,19?,20-,21?,23-,24+,25?/m1/s1 |
| InChIKey | SRRCKVBIMQIXTO-WSAQQAJFSA-N |
| XLogP | 5.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|