C28H42O4 — CID 158481217
(2R,4R,7R,14R)-4-benzyl-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one (PubChem CID 158481217) has the molecular formula C28H42O4 and a molecular weight of 442.64 g/mol. Its IUPAC name is (2R,4R,7R,14R)-4-benzyl-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one.
| Compound Name | (2R,4R,7R,14R)-4-benzyl-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one |
|---|---|
| PubChem CID | 158481217 |
| Molecular Formula | C28H42O4 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | (2R,4R,7R,14R)-4-benzyl-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one |
| SMILES | COCOC1C[C@@](C)(Cc2ccccc2)C(=O)[C@H](C)C23CCC(OC)C2[C@@]1(C)[C@H](C)CC3 |
| InChI | InChI=1S/C28H42O4/c1-19-12-14-28-15-13-22(31-6)24(28)27(19,4)23(32-18-30-5)17-26(3,25(29)20(28)2)16-21-10-8-7-9-11-21/h7-11,19-20,22-24H,12-18H2,1-6H3/t19-,20+,22?,23?,24?,26-,27+,28?/m1/s1 |
| InChIKey | NASZNVKDFGKCFQ-URQSFLJRSA-N |
| XLogP | 5.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|