C24H41FO4 — CID 157273745
(2R,4R,6R,7R,14R)-4-(3-fluoropropyl)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one (PubChem CID 157273745) has the molecular formula C24H41FO4 and a molecular weight of 412.59 g/mol. Its IUPAC name is (2R,4R,6R,7R,14R)-4-(3-fluoropropyl)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one.
| Compound Name | (2R,4R,6R,7R,14R)-4-(3-fluoropropyl)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one |
|---|---|
| PubChem CID | 157273745 |
| Molecular Formula | C24H41FO4 |
| Molecular Weight | 412.59 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | (2R,4R,6R,7R,14R)-4-(3-fluoropropyl)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one |
| SMILES | COCO[C@@H]1C[C@@](C)(CCCF)C(=O)[C@H](C)C23CCC(OC)C2[C@@]1(C)[C@H](C)CC3 |
| InChI | InChI=1S/C24H41FO4/c1-16-8-11-24-12-9-18(28-6)20(24)23(16,4)19(29-15-27-5)14-22(3,10-7-13-25)21(26)17(24)2/h16-20H,7-15H2,1-6H3/t16-,17+,18?,19-,20?,22-,23+,24?/m1/s1 |
| InChIKey | CXIXDSIHXCCZJA-PQTKAYGQSA-N |
| XLogP | 5.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|