C23H38O4 — CID 158341754
(2R,4S,6R,7R,14R)-4-ethenyl-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one (PubChem CID 158341754) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is (2R,4S,6R,7R,14R)-4-ethenyl-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one.
| Compound Name | (2R,4S,6R,7R,14R)-4-ethenyl-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one |
|---|---|
| PubChem CID | 158341754 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | (2R,4S,6R,7R,14R)-4-ethenyl-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one |
| SMILES | C=C[C@]1(C)C[C@@H](OCOC)[C@@]2(C)C3C(OC)CCC3(CC[C@H]2C)[C@@H](C)C1=O |
| InChI | InChI=1S/C23H38O4/c1-8-21(4)13-18(27-14-25-6)22(5)15(2)9-11-23(16(3)20(21)24)12-10-17(26-7)19(22)23/h8,15-19H,1,9-14H2,2-7H3/t15-,16+,17?,18-,19?,21-,22+,23?/m1/s1 |
| InChIKey | PFXAITXOSXPKLI-QOVFQUITSA-N |
| XLogP | 4.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|