C21H34O3 — CID 157382045
(1R,2R,4S,6R,7R)-4-ethenyl-6-hydroxy-9-methoxy-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one (PubChem CID 157382045) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (1R,2R,4S,6R,7R)-4-ethenyl-6-hydroxy-9-methoxy-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one.
| Compound Name | (1R,2R,4S,6R,7R)-4-ethenyl-6-hydroxy-9-methoxy-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one |
|---|---|
| PubChem CID | 157382045 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (1R,2R,4S,6R,7R)-4-ethenyl-6-hydroxy-9-methoxy-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one |
| SMILES | C=C[C@]1(C)C[C@@H](O)[C@]2(C)C(C)CC[C@]3(CCC(OC)C32)[C@@H](C)C1=O |
| InChI | InChI=1S/C21H34O3/c1-7-19(4)12-16(22)20(5)13(2)8-10-21(14(3)18(19)23)11-9-15(24-6)17(20)21/h7,13-17,22H,1,8-12H2,2-6H3/t13?,14-,15?,16+,17?,19+,20-,21-/m0/s1 |
| InChIKey | GBRKURGUBRXTRD-LEKRJUSRSA-N |
| XLogP | 4.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|