C30H40BNO7 — CID 172710301
[(1R,2R,4S,6R,7R,8S,9R,14R)-4-ethenyl-9-methoxy-2,4,7,14-tetramethyl-3-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]-(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)carbamic acid (PubChem CID 172710301) has the molecular formula C30H40BNO7 and a molecular weight of 537.46 g/mol. Its IUPAC name is [(1R,2R,4S,6R,7R,8S,9R,14R)-4-ethenyl-9-methoxy-2,4,7,14-tetramethyl-3-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]-(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)carbamic acid.
| Compound Name | [(1R,2R,4S,6R,7R,8S,9R,14R)-4-ethenyl-9-methoxy-2,4,7,14-tetramethyl-3-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]-(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)carbamic acid |
|---|---|
| PubChem CID | 172710301 |
| Molecular Formula | C30H40BNO7 |
| Molecular Weight | 537.46 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | [(1R,2R,4S,6R,7R,8S,9R,14R)-4-ethenyl-9-methoxy-2,4,7,14-tetramethyl-3-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]-(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)carbamic acid |
| SMILES | C=C[C@]1(C)C[C@@H](N(C(=O)O)C(=O)c2ccc3c(c2)B(O)OC3)[C@]2(C)[C@H](C)CC[C@]3(CC[C@@H](OC)[C@@H]32)[C@@H](C)C1=O |
| InChI | InChI=1S/C30H40BNO7/c1-7-28(4)15-23(32(27(35)36)26(34)19-8-9-20-16-39-31(37)21(20)14-19)29(5)17(2)10-12-30(18(3)25(28)33)13-11-22(38-6)24(29)30/h7-9,14,17-18,22-24,37H,1,10-13,15-16H2,2-6H3,(H,35,36)/t17-,18+,22-,23-,24-,28-,29+,30+/m1/s1 |
| InChIKey | FDTDAJKBEUSEEJ-AZCWKOBPSA-N |
| XLogP | 4.04 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|