C26H36O4S — CID 59439290
S-[(2R,4R,6R,7R,9R,14R)-6-hydroxy-9-methoxy-2,4,7,14-tetramethyl-3-oxo-4-tricyclo[5.4.3.01,8]tetradecanyl] benzenecarbothioate (PubChem CID 59439290) has the molecular formula C26H36O4S and a molecular weight of 444.64 g/mol. Its IUPAC name is S-[(2R,4R,6R,7R,9R,14R)-6-hydroxy-9-methoxy-2,4,7,14-tetramethyl-3-oxo-4-tricyclo[5.4.3.01,8]tetradecanyl] benzenecarbothioate.
| Compound Name | S-[(2R,4R,6R,7R,9R,14R)-6-hydroxy-9-methoxy-2,4,7,14-tetramethyl-3-oxo-4-tricyclo[5.4.3.01,8]tetradecanyl] benzenecarbothioate |
|---|---|
| PubChem CID | 59439290 |
| Molecular Formula | C26H36O4S |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | S-[(2R,4R,6R,7R,9R,14R)-6-hydroxy-9-methoxy-2,4,7,14-tetramethyl-3-oxo-4-tricyclo[5.4.3.01,8]tetradecanyl] benzenecarbothioate |
| SMILES | COC1CCC23CC[C@@H](C)[C@](C)(C12)[C@H](O)C[C@@](C)(SC(=O)c1ccccc1)C(=O)[C@@H]3C |
| InChI | InChI=1S/C26H36O4S/c1-16-11-13-26-14-12-19(30-5)21(26)25(16,4)20(27)15-24(3,22(28)17(26)2)31-23(29)18-9-7-6-8-10-18/h6-10,16-17,19-21,27H,11-15H2,1-5H3/t16-,17+,19?,20-,21?,24-,25+,26?/m1/s1 |
| InChIKey | ZONRYLGKPRFPGD-BRRWUWANSA-N |
| XLogP | 5.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|