C21H34O2 — CID 58306379
(1S,2R,4S,6R,7R,9R)-4-ethenyl-6-hydroxy-2,4,7,9,14-pentamethyltricyclo[5.4.3.01,8]tetradecan-3-one (PubChem CID 58306379) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (1S,2R,4S,6R,7R,9R)-4-ethenyl-6-hydroxy-2,4,7,9,14-pentamethyltricyclo[5.4.3.01,8]tetradecan-3-one.
| Compound Name | (1S,2R,4S,6R,7R,9R)-4-ethenyl-6-hydroxy-2,4,7,9,14-pentamethyltricyclo[5.4.3.01,8]tetradecan-3-one |
|---|---|
| PubChem CID | 58306379 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (1S,2R,4S,6R,7R,9R)-4-ethenyl-6-hydroxy-2,4,7,9,14-pentamethyltricyclo[5.4.3.01,8]tetradecan-3-one |
| SMILES | C=C[C@]1(C)C[C@@H](O)[C@]2(C)C(C)CC[C@]3(CCC(C)C32)[C@@H](C)C1=O |
| InChI | InChI=1S/C21H34O2/c1-7-19(5)12-16(22)20(6)14(3)9-11-21(15(4)18(19)23)10-8-13(2)17(20)21/h7,13-17,22H,1,8-12H2,2-6H3/t13?,14?,15-,16+,17?,19+,20-,21+/m0/s1 |
| InChIKey | CHFONWVHWFUBEX-XZBBBLCYSA-N |
| XLogP | 4.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|