C20H30O2 — CID 164710685
(1S,2R,4S,7R,8S,14R)-4-ethenyl-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecane-3,9-dione (PubChem CID 164710685) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1S,2R,4S,7R,8S,14R)-4-ethenyl-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecane-3,9-dione.
| Compound Name | (1S,2R,4S,7R,8S,14R)-4-ethenyl-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecane-3,9-dione |
|---|---|
| PubChem CID | 164710685 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1S,2R,4S,7R,8S,14R)-4-ethenyl-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecane-3,9-dione |
| SMILES | C=C[C@]1(C)CC[C@]2(C)[C@H](C)CC[C@]3(CCC(=O)[C@@H]23)[C@@H](C)C1=O |
| InChI | InChI=1S/C20H30O2/c1-6-18(4)11-12-19(5)13(2)7-9-20(14(3)17(18)22)10-8-15(21)16(19)20/h6,13-14,16H,1,7-12H2,2-5H3/t13-,14+,16+,18-,19-,20+/m1/s1 |
| InChIKey | PLXOKCBRDFAPLW-YWVZRHABSA-N |
| XLogP | 4.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|