C20H33NO — CID 166655628
(1R,2R,3S,4S,7R,8S,14R)-4-ethenyl-9-imino-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-ol (PubChem CID 166655628) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is (1R,2R,3S,4S,7R,8S,14R)-4-ethenyl-9-imino-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-ol.
| Compound Name | (1R,2R,3S,4S,7R,8S,14R)-4-ethenyl-9-imino-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-ol |
|---|---|
| PubChem CID | 166655628 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | (1R,2R,3S,4S,7R,8S,14R)-4-ethenyl-9-imino-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-ol |
| SMILES | [H]/N=C1/CC[C@@]23CC[C@@H](C)[C@@](C)(CC[C@@](C)(C=C)[C@@H](O)[C@@H]2C)[C@H]13 |
| InChI | InChI=1S/C20H33NO/c1-6-18(4)11-12-19(5)13(2)7-9-20(14(3)17(18)22)10-8-15(21)16(19)20/h6,13-14,16-17,21-22H,1,7-12H2,2-5H3/b21-15-/t13-,14+,16+,17+,18-,19-,20+/m1/s1 |
| InChIKey | DNLOMJXCXYPMFF-SBSSETLZSA-N |
| XLogP | 4.82 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|