C20H30O4 — CID 177444012
(1R,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3,6-dihydroxy-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecane-9,13-dione (PubChem CID 177444012) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1R,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3,6-dihydroxy-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecane-9,13-dione.
| Compound Name | (1R,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3,6-dihydroxy-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecane-9,13-dione |
|---|---|
| PubChem CID | 177444012 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (1R,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3,6-dihydroxy-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecane-9,13-dione |
| SMILES | C=C[C@]1(C)C[C@@H](O)[C@@]2(C)[C@@H]3C(=O)CC[C@@]3(CC(=O)[C@@H]2C)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C20H30O4/c1-6-18(4)10-15(23)19(5)11(2)14(22)9-20(12(3)17(18)24)8-7-13(21)16(19)20/h6,11-12,15-17,23-24H,1,7-10H2,2-5H3/t11-,12-,15+,16-,17-,18+,19-,20+/m0/s1 |
| InChIKey | ZCQXMVNGVBHRQL-REAOGIBKSA-N |
| XLogP | 2.52 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|