C25H38N2O6 — CID 10300550
[(1S,2R,3S,4S,6R,7S,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(azetidin-3-yloxycarbonyl)carbamate (PubChem CID 10300550) has the molecular formula C25H38N2O6 and a molecular weight of 462.59 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7S,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(azetidin-3-yloxycarbonyl)carbamate.
| Compound Name | [(1S,2R,3S,4S,6R,7S,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(azetidin-3-yloxycarbonyl)carbamate |
|---|---|
| PubChem CID | 10300550 |
| Molecular Formula | C25H38N2O6 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7S,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(azetidin-3-yloxycarbonyl)carbamate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)NC(=O)OC2CNC2)[C@@]2(C)C(C)CC[C@]3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C25H38N2O6/c1-6-23(4)11-18(33-22(31)27-21(30)32-16-12-26-13-16)24(5)14(2)7-9-25(15(3)20(23)29)10-8-17(28)19(24)25/h6,14-16,18-20,26,29H,1,7-13H2,2-5H3,(H,27,30,31)/t14?,15-,18+,19-,20-,23+,24+,25-/m0/s1 |
| InChIKey | PMYWDJGCKKCQJN-FZSQGVRNSA-N |
| XLogP | 3.18 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|