C28H35BFNO6 — CID 154618919
[(1S,2R,4S,6R,7R,8R,14R)-4-ethenyl-2,4,7,14-tetramethyl-3,9-dioxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamate (PubChem CID 154618919) has the molecular formula C28H35BFNO6 and a molecular weight of 511.40 g/mol. Its IUPAC name is [(1S,2R,4S,6R,7R,8R,14R)-4-ethenyl-2,4,7,14-tetramethyl-3,9-dioxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamate.
| Compound Name | [(1S,2R,4S,6R,7R,8R,14R)-4-ethenyl-2,4,7,14-tetramethyl-3,9-dioxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamate |
|---|---|
| PubChem CID | 154618919 |
| Molecular Formula | C28H35BFNO6 |
| Molecular Weight | 511.40 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | [(1S,2R,4S,6R,7R,8R,14R)-4-ethenyl-2,4,7,14-tetramethyl-3,9-dioxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)Nc2cc3c(cc2F)COB3O)[C@]2(C)[C@H](C)CC[C@]3(CCC(=O)[C@H]32)[C@@H](C)C1=O |
| InChI | InChI=1S/C28H35BFNO6/c1-6-26(4)13-22(37-25(34)31-20-12-18-17(11-19(20)30)14-36-29(18)35)27(5)15(2)7-9-28(16(3)24(26)33)10-8-21(32)23(27)28/h6,11-12,15-16,22-23,35H,1,7-10,13-14H2,2-5H3,(H,31,34)/t15-,16+,22-,23+,26-,27+,28+/m1/s1 |
| InChIKey | WWNHHVMLAORUJU-PNONWNFHSA-N |
| XLogP | 4.16 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|