C31H44BNO6 — CID 159734132
[(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 3-[5-(aminomethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-yl]propanoate (PubChem CID 159734132) has the molecular formula C31H44BNO6 and a molecular weight of 537.51 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 3-[5-(aminomethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-yl]propanoate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 3-[5-(aminomethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-yl]propanoate |
|---|---|
| PubChem CID | 159734132 |
| Molecular Formula | C31H44BNO6 |
| Molecular Weight | 537.51 g/mol |
| Exact Mass | 537.33 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 3-[5-(aminomethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-yl]propanoate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CCc2cc3c(cc2CN)COB3O)[C@]2(C)[C@H](C)CC[C@]3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C31H44BNO6/c1-6-29(4)15-25(30(5)18(2)9-11-31(19(3)28(29)36)12-10-24(34)27(30)31)39-26(35)8-7-20-14-23-22(13-21(20)16-33)17-38-32(23)37/h6,13-14,18-19,25,27-28,36-37H,1,7-12,15-17,33H2,2-5H3/t18-,19+,25-,27+,28+,29-,30+,31+/m1/s1 |
| InChIKey | NBPSWIUPWPHVHV-RRXZYCJXSA-N |
| XLogP | 3.20 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|