C29H46O5S — CID 163530704
[(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(2-hydroxy-5-methylcyclohexyl)sulfanylacetate (PubChem CID 163530704) has the molecular formula C29H46O5S and a molecular weight of 506.75 g/mol. Its IUPAC name is [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(2-hydroxy-5-methylcyclohexyl)sulfanylacetate.
| Compound Name | [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(2-hydroxy-5-methylcyclohexyl)sulfanylacetate |
|---|---|
| PubChem CID | 163530704 |
| Molecular Formula | C29H46O5S |
| Molecular Weight | 506.75 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(2-hydroxy-5-methylcyclohexyl)sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSC2CC(C)CCC2O)[C@]2(C)C(C)CCC3(CCC(=O)C32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C29H46O5S/c1-7-27(5)15-23(34-24(32)16-35-22-14-17(2)8-9-20(22)30)28(6)18(3)10-12-29(19(4)26(27)33)13-11-21(31)25(28)29/h7,17-20,22-23,25-26,30,33H,1,8-16H2,2-6H3/t17?,18?,19-,20?,22?,23+,25?,26-,27+,28-,29?/m0/s1 |
| InChIKey | DSTBSLZJWSNLQH-XEMXNHIRSA-N |
| XLogP | 5.18 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.75 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|