C27H43NO5S — CID 139397410
[(1R,2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,13-tetramethyl-9-oxo-6-tricyclo[5.4.2.01,8]tridecanyl] 2-[(1R,2R,4R)-4-amino-2-hydroxycyclohexyl]sulfanylacetate (PubChem CID 139397410) has the molecular formula C27H43NO5S and a molecular weight of 493.71 g/mol. Its IUPAC name is [(1R,2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,13-tetramethyl-9-oxo-6-tricyclo[5.4.2.01,8]tridecanyl] 2-[(1R,2R,4R)-4-amino-2-hydroxycyclohexyl]sulfanylacetate.
| Compound Name | [(1R,2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,13-tetramethyl-9-oxo-6-tricyclo[5.4.2.01,8]tridecanyl] 2-[(1R,2R,4R)-4-amino-2-hydroxycyclohexyl]sulfanylacetate |
|---|---|
| PubChem CID | 139397410 |
| Molecular Formula | C27H43NO5S |
| Molecular Weight | 493.71 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | [(1R,2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,13-tetramethyl-9-oxo-6-tricyclo[5.4.2.01,8]tridecanyl] 2-[(1R,2R,4R)-4-amino-2-hydroxycyclohexyl]sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CS[C@@H]2CC[C@@H](N)C[C@H]2O)[C@]2(C)C(C)C[C@]3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C27H43NO5S/c1-6-25(4)13-21(33-22(31)14-34-20-8-7-17(28)11-19(20)30)26(5)15(2)12-27(16(3)24(25)32)10-9-18(29)23(26)27/h6,15-17,19-21,23-24,30,32H,1,7-14,28H2,2-5H3/t15?,16-,17+,19+,20+,21+,23-,24-,25+,26-,27+/m0/s1 |
| InChIKey | CBJHFECPKWCTPJ-VCANJQCPSA-N |
| XLogP | 3.48 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.71 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|