C28H43NO5S — CID 123967046
(11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.01,5.05,14]tetradecanyl) 2-(4-amino-2-hydroxycyclohexyl)sulfanylacetate (PubChem CID 123967046) has the molecular formula C28H43NO5S and a molecular weight of 505.72 g/mol. Its IUPAC name is (11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.01,5.05,14]tetradecanyl) 2-(4-amino-2-hydroxycyclohexyl)sulfanylacetate.
| Compound Name | (11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.01,5.05,14]tetradecanyl) 2-(4-amino-2-hydroxycyclohexyl)sulfanylacetate |
|---|---|
| PubChem CID | 123967046 |
| Molecular Formula | C28H43NO5S |
| Molecular Weight | 505.72 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | (11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.01,5.05,14]tetradecanyl) 2-(4-amino-2-hydroxycyclohexyl)sulfanylacetate |
| SMILES | C=CC1(C)CC(OC(=O)CSC2CCC(N)CC2O)C2(C)C(C)CC34C(=O)CCC3(C(C)C1O)C24 |
| InChI | InChI=1S/C28H43NO5S/c1-6-25(4)13-21(34-22(32)14-35-19-8-7-17(29)11-18(19)30)26(5)15(2)12-28-20(31)9-10-27(28,24(26)28)16(3)23(25)33/h6,15-19,21,23-24,30,33H,1,7-14,29H2,2-5H3 |
| InChIKey | CQZSFTVRKSQASH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.72 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|