C30H40O7S — CID 89007770
[(8R,9R,11S,12S,13R)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] 2-(4-methylphenyl)sulfonyloxyacetate (PubChem CID 89007770) has the molecular formula C30H40O7S and a molecular weight of 544.71 g/mol. Its IUPAC name is [(8R,9R,11S,12S,13R)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] 2-(4-methylphenyl)sulfonyloxyacetate.
| Compound Name | [(8R,9R,11S,12S,13R)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] 2-(4-methylphenyl)sulfonyloxyacetate |
|---|---|
| PubChem CID | 89007770 |
| Molecular Formula | C30H40O7S |
| Molecular Weight | 544.71 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | [(8R,9R,11S,12S,13R)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] 2-(4-methylphenyl)sulfonyloxyacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)COS(=O)(=O)c2ccc(C)cc2)C2(C)C(C)CC34CC(CCC3=O)(C42)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C30H40O7S/c1-7-27(5)15-23(37-24(32)16-36-38(34,35)21-10-8-18(2)9-11-21)28(6)19(3)14-30-17-29(26(28)30,13-12-22(30)31)20(4)25(27)33/h7-11,19-20,23,25-26,33H,1,12-17H2,2-6H3/t19?,20-,23+,25-,26?,27+,28?,29?,30?/m0/s1 |
| InChIKey | PDUUFAOZMKODPQ-OACZTWJHSA-N |
| XLogP | 4.61 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.71 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|