C31H48O7S — CID 155364165
[(1R,4R,5R,6S,7S)-4-butyl-7-ethenyl-6-hydroxy-2,2,5,7-tetramethyl-4-(3-oxobutyl)cyclooctyl] 2-(4-methylphenyl)sulfonyloxyacetate (PubChem CID 155364165) has the molecular formula C31H48O7S and a molecular weight of 564.79 g/mol. Its IUPAC name is [(1R,4R,5R,6S,7S)-4-butyl-7-ethenyl-6-hydroxy-2,2,5,7-tetramethyl-4-(3-oxobutyl)cyclooctyl] 2-(4-methylphenyl)sulfonyloxyacetate.
| Compound Name | [(1R,4R,5R,6S,7S)-4-butyl-7-ethenyl-6-hydroxy-2,2,5,7-tetramethyl-4-(3-oxobutyl)cyclooctyl] 2-(4-methylphenyl)sulfonyloxyacetate |
|---|---|
| PubChem CID | 155364165 |
| Molecular Formula | C31H48O7S |
| Molecular Weight | 564.79 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | [(1R,4R,5R,6S,7S)-4-butyl-7-ethenyl-6-hydroxy-2,2,5,7-tetramethyl-4-(3-oxobutyl)cyclooctyl] 2-(4-methylphenyl)sulfonyloxyacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)COS(=O)(=O)c2ccc(C)cc2)C(C)(C)C[C@@](CCCC)(CCC(C)=O)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C31H48O7S/c1-9-11-17-31(18-16-23(4)32)21-29(6,7)26(19-30(8,10-2)28(34)24(31)5)38-27(33)20-37-39(35,36)25-14-12-22(3)13-15-25/h10,12-15,24,26,28,34H,2,9,11,16-21H2,1,3-8H3/t24-,26+,28-,30+,31+/m0/s1 |
| InChIKey | IJZUSEIMUUJVIF-YFVILTQKSA-N |
| XLogP | 6.17 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.79 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|