C28H40O8S — CID 164889770
[(1'R,3'R,4'S,6'S,7'R,8'R,13'R)-4'-ethyl-3'-hydroxy-7',13'-dimethylspiro[1,3-dioxolane-2,9'-tricyclo[5.4.2.01,8]tridecane]-6'-yl] 2-(4-methylphenyl)sulfonyloxyacetate (PubChem CID 164889770) has the molecular formula C28H40O8S and a molecular weight of 536.69 g/mol. Its IUPAC name is [(1'R,3'R,4'S,6'S,7'R,8'R,13'R)-4'-ethyl-3'-hydroxy-7',13'-dimethylspiro[1,3-dioxolane-2,9'-tricyclo[5.4.2.01,8]tridecane]-6'-yl] 2-(4-methylphenyl)sulfonyloxyacetate.
| Compound Name | [(1'R,3'R,4'S,6'S,7'R,8'R,13'R)-4'-ethyl-3'-hydroxy-7',13'-dimethylspiro[1,3-dioxolane-2,9'-tricyclo[5.4.2.01,8]tridecane]-6'-yl] 2-(4-methylphenyl)sulfonyloxyacetate |
|---|---|
| PubChem CID | 164889770 |
| Molecular Formula | C28H40O8S |
| Molecular Weight | 536.69 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | [(1'R,3'R,4'S,6'S,7'R,8'R,13'R)-4'-ethyl-3'-hydroxy-7',13'-dimethylspiro[1,3-dioxolane-2,9'-tricyclo[5.4.2.01,8]tridecane]-6'-yl] 2-(4-methylphenyl)sulfonyloxyacetate |
| SMILES | CC[C@H]1C[C@H](OC(=O)COS(=O)(=O)c2ccc(C)cc2)[C@]2(C)[C@H](C)C[C@]3(CCC4(OCCO4)[C@H]32)C[C@H]1O |
| InChI | InChI=1S/C28H40O8S/c1-5-20-14-23(36-24(30)17-35-37(31,32)21-8-6-18(2)7-9-21)26(4)19(3)15-27(16-22(20)29)10-11-28(25(26)27)33-12-13-34-28/h6-9,19-20,22-23,25,29H,5,10-17H2,1-4H3/t19-,20+,22-,23+,25+,26+,27-/m1/s1 |
| InChIKey | UDLWJAFIOZRJTL-YPSJKIHESA-N |
| XLogP | 3.98 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.69 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|