C28H40O7S — CID 155439206
[(1R,2R,4R,6R,7R,8S,9R,14R)-9-methoxy-2,4,7,14-tetramethyl-3-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(4-methylphenyl)sulfonyloxyacetate (PubChem CID 155439206) has the molecular formula C28H40O7S and a molecular weight of 520.69 g/mol. Its IUPAC name is [(1R,2R,4R,6R,7R,8S,9R,14R)-9-methoxy-2,4,7,14-tetramethyl-3-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(4-methylphenyl)sulfonyloxyacetate.
| Compound Name | [(1R,2R,4R,6R,7R,8S,9R,14R)-9-methoxy-2,4,7,14-tetramethyl-3-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(4-methylphenyl)sulfonyloxyacetate |
|---|---|
| PubChem CID | 155439206 |
| Molecular Formula | C28H40O7S |
| Molecular Weight | 520.69 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | [(1R,2R,4R,6R,7R,8S,9R,14R)-9-methoxy-2,4,7,14-tetramethyl-3-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(4-methylphenyl)sulfonyloxyacetate |
| SMILES | CO[C@@H]1CC[C@@]23CC[C@@H](C)[C@@](C)([C@H](OC(=O)COS(=O)(=O)c4ccc(C)cc4)C[C@@H](C)C(=O)[C@@H]2C)[C@@H]13 |
| InChI | InChI=1S/C28H40O7S/c1-17-7-9-21(10-8-17)36(31,32)34-16-24(29)35-23-15-18(2)25(30)20(4)28-13-11-19(3)27(23,5)26(28)22(33-6)12-14-28/h7-10,18-20,22-23,26H,11-16H2,1-6H3/t18-,19-,20+,22-,23-,26-,27+,28+/m1/s1 |
| InChIKey | BLVHVJLQDWLRKG-FYBIBNLASA-N |
| XLogP | 4.70 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.69 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|