C29H40O8S — CID 138747067
[(1S,2R,3S,4R,6R,7R,14R)-3-hydroxy-2,4,7,14-tetramethyl-4-(oxiran-2-yl)-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(4-methylphenyl)sulfonyloxyacetate (PubChem CID 138747067) has the molecular formula C29H40O8S and a molecular weight of 548.70 g/mol. Its IUPAC name is [(1S,2R,3S,4R,6R,7R,14R)-3-hydroxy-2,4,7,14-tetramethyl-4-(oxiran-2-yl)-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(4-methylphenyl)sulfonyloxyacetate.
| Compound Name | [(1S,2R,3S,4R,6R,7R,14R)-3-hydroxy-2,4,7,14-tetramethyl-4-(oxiran-2-yl)-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(4-methylphenyl)sulfonyloxyacetate |
|---|---|
| PubChem CID | 138747067 |
| Molecular Formula | C29H40O8S |
| Molecular Weight | 548.70 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | [(1S,2R,3S,4R,6R,7R,14R)-3-hydroxy-2,4,7,14-tetramethyl-4-(oxiran-2-yl)-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(4-methylphenyl)sulfonyloxyacetate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(=O)O[C@@H]2C[C@@](C)(C3CO3)[C@@H](O)[C@H](C)[C@]34CCC(=O)C3[C@@]2(C)[C@H](C)CC4)cc1 |
| InChI | InChI=1S/C29H40O8S/c1-17-6-8-20(9-7-17)38(33,34)36-16-24(31)37-22-14-27(4,23-15-35-23)26(32)19(3)29-12-10-18(2)28(22,5)25(29)21(30)11-13-29/h6-9,18-19,22-23,25-26,32H,10-16H2,1-5H3/t18-,19+,22-,23?,25?,26+,27+,28+,29+/m1/s1 |
| InChIKey | JBKBEWMKFQTVNQ-GBELOWFDSA-N |
| XLogP | 3.82 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.70 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|