C30H41NO7S — CID 172917673
[(1R,2R,4S,6R,7R,8R,10S)-4-[(2E)-2-hydroxyiminoethyl]-2,4,7,8-tetramethyl-3-oxo-6-tetracyclo[8.4.1.01,11.07,11]pentadecanyl] 2-(4-methylphenyl)sulfonyloxyacetate (PubChem CID 172917673) has the molecular formula C30H41NO7S and a molecular weight of 559.73 g/mol. Its IUPAC name is [(1R,2R,4S,6R,7R,8R,10S)-4-[(2E)-2-hydroxyiminoethyl]-2,4,7,8-tetramethyl-3-oxo-6-tetracyclo[8.4.1.01,11.07,11]pentadecanyl] 2-(4-methylphenyl)sulfonyloxyacetate.
| Compound Name | [(1R,2R,4S,6R,7R,8R,10S)-4-[(2E)-2-hydroxyiminoethyl]-2,4,7,8-tetramethyl-3-oxo-6-tetracyclo[8.4.1.01,11.07,11]pentadecanyl] 2-(4-methylphenyl)sulfonyloxyacetate |
|---|---|
| PubChem CID | 172917673 |
| Molecular Formula | C30H41NO7S |
| Molecular Weight | 559.73 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | [(1R,2R,4S,6R,7R,8R,10S)-4-[(2E)-2-hydroxyiminoethyl]-2,4,7,8-tetramethyl-3-oxo-6-tetracyclo[8.4.1.01,11.07,11]pentadecanyl] 2-(4-methylphenyl)sulfonyloxyacetate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(=O)O[C@@H]2C[C@](C)(C/C=N/O)C(=O)[C@H](C)[C@]34CCCC35[C@@H](C[C@@H](C)[C@@]25C)C4)cc1 |
| InChI | InChI=1S/C30H41NO7S/c1-19-7-9-23(10-8-19)39(35,36)37-18-25(32)38-24-17-27(4,13-14-31-34)26(33)21(3)29-11-6-12-30(29)22(16-29)15-20(2)28(24,30)5/h7-10,14,20-22,24,34H,6,11-13,15-18H2,1-5H3/b31-14+/t20-,21+,22+,24-,27+,28+,29-,30?/m1/s1 |
| InChIKey | MHAXOLPCUQUZFQ-GVZVBGTISA-N |
| XLogP | 5.30 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.73 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|