C49H54O4S2 — CID 89007649
[(8R,9R,11S,12S,13R)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] 2-[3-(tritylsulfanylmethyl)phenyl]sulfanylacetate (PubChem CID 89007649) has the molecular formula C49H54O4S2 and a molecular weight of 771.10 g/mol. Its IUPAC name is [(8R,9R,11S,12S,13R)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] 2-[3-(tritylsulfanylmethyl)phenyl]sulfanylacetate.
| Compound Name | [(8R,9R,11S,12S,13R)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] 2-[3-(tritylsulfanylmethyl)phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 89007649 |
| Molecular Formula | C49H54O4S2 |
| Molecular Weight | 771.10 g/mol |
| Exact Mass | 770.35 |
| IUPAC Name | [(8R,9R,11S,12S,13R)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] 2-[3-(tritylsulfanylmethyl)phenyl]sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSc2cccc(CSC(c3ccccc3)(c3ccccc3)c3ccccc3)c2)C2(C)C(C)CC34CC(CCC3=O)(C42)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C49H54O4S2/c1-6-45(4)29-41(46(5)33(2)28-48-32-47(44(46)48,26-25-40(48)50)34(3)43(45)52)53-42(51)31-54-39-24-16-17-35(27-39)30-55-49(36-18-10-7-11-19-36,37-20-12-8-13-21-37)38-22-14-9-15-23-38/h6-24,27,33-34,41,43-44,52H,1,25-26,28-32H2,2-5H3/t33?,34-,41+,43-,44?,45+,46?,47?,48?/m0/s1 |
| InChIKey | BJCWGIWCUXUHBH-USIDDOHSSA-N |
| XLogP | 10.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.10 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|