C33H51NO7S — CID 123572395
(11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.01,5.05,14]tetradecanyl) 2-[2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]sulfanylacetate (PubChem CID 123572395) has the molecular formula C33H51NO7S and a molecular weight of 605.84 g/mol. Its IUPAC name is (11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.01,5.05,14]tetradecanyl) 2-[2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]sulfanylacetate.
| Compound Name | (11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.01,5.05,14]tetradecanyl) 2-[2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]sulfanylacetate |
|---|---|
| PubChem CID | 123572395 |
| Molecular Formula | C33H51NO7S |
| Molecular Weight | 605.84 g/mol |
| Exact Mass | 605.34 |
| IUPAC Name | (11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.01,5.05,14]tetradecanyl) 2-[2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]sulfanylacetate |
| SMILES | C=CC1(C)CC(OC(=O)CSC2CCC(NC(=O)OC(C)(C)C)CC2O)C2(C)C(C)CC34C(=O)CCC3(C(C)C1O)C24 |
| InChI | InChI=1S/C33H51NO7S/c1-9-30(7)16-24(31(8)18(2)15-33-23(36)12-13-32(33,27(31)33)19(3)26(30)38)40-25(37)17-42-22-11-10-20(14-21(22)35)34-28(39)41-29(4,5)6/h9,18-22,24,26-27,35,38H,1,10-17H2,2-8H3,(H,34,39) |
| InChIKey | DQNLHTAWYIYGOG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.84 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|