C31H50N2O6S — CID 46181093
[(2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(1R,2S,5R)-5-[[(2R)-2-aminopropanoyl]amino]-2-hydroxycyclohexyl]sulfanylacetate (PubChem CID 46181093) has the molecular formula C31H50N2O6S and a molecular weight of 578.82 g/mol. Its IUPAC name is [(2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(1R,2S,5R)-5-[[(2R)-2-aminopropanoyl]amino]-2-hydroxycyclohexyl]sulfanylacetate.
| Compound Name | [(2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(1R,2S,5R)-5-[[(2R)-2-aminopropanoyl]amino]-2-hydroxycyclohexyl]sulfanylacetate |
|---|---|
| PubChem CID | 46181093 |
| Molecular Formula | C31H50N2O6S |
| Molecular Weight | 578.82 g/mol |
| Exact Mass | 578.34 |
| IUPAC Name | [(2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(1R,2S,5R)-5-[[(2R)-2-aminopropanoyl]amino]-2-hydroxycyclohexyl]sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CS[C@@H]2C[C@H](NC(=O)[C@@H](C)N)CC[C@@H]2O)[C@]2(C)C(C)CCC3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C31H50N2O6S/c1-7-29(5)15-24(30(6)17(2)10-12-31(18(3)27(29)37)13-11-22(35)26(30)31)39-25(36)16-40-23-14-20(8-9-21(23)34)33-28(38)19(4)32/h7,17-21,23-24,26-27,34,37H,1,8-16,32H2,2-6H3,(H,33,38)/t17?,18-,19+,20+,21-,23+,24+,26-,27-,29+,30-,31?/m0/s1 |
| InChIKey | AGUWUFHKVDNMHN-LOKDAOQCSA-N |
| XLogP | 3.37 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.82 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|