C31H52N2O5S — CID 24868320
[(1R,2S,3R,4R,6S,7S,8S)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[1-[[(2S)-2-amino-3-methylbutanoyl]amino]-2-methylpropan-2-yl]sulfanylacetate (PubChem CID 24868320) has the molecular formula C31H52N2O5S and a molecular weight of 564.83 g/mol. Its IUPAC name is [(1R,2S,3R,4R,6S,7S,8S)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[1-[[(2S)-2-amino-3-methylbutanoyl]amino]-2-methylpropan-2-yl]sulfanylacetate.
| Compound Name | [(1R,2S,3R,4R,6S,7S,8S)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[1-[[(2S)-2-amino-3-methylbutanoyl]amino]-2-methylpropan-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 24868320 |
| Molecular Formula | C31H52N2O5S |
| Molecular Weight | 564.83 g/mol |
| Exact Mass | 564.36 |
| IUPAC Name | [(1R,2S,3R,4R,6S,7S,8S)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[1-[[(2S)-2-amino-3-methylbutanoyl]amino]-2-methylpropan-2-yl]sulfanylacetate |
| SMILES | C=C[C@@]1(C)C[C@H](OC(=O)CSC(C)(C)CNC(=O)[C@@H](N)C(C)C)[C@@]2(C)C(C)CC[C@@]3(CCC(=O)[C@@H]32)[C@H](C)[C@H]1O |
| InChI | InChI=1S/C31H52N2O5S/c1-10-29(8)15-22(38-23(35)16-39-28(6,7)17-33-27(37)24(32)18(2)3)30(9)19(4)11-13-31(20(5)26(29)36)14-12-21(34)25(30)31/h10,18-20,22,24-26,36H,1,11-17,32H2,2-9H3,(H,33,37)/t19?,20-,22+,24+,25-,26-,29+,30-,31-/m1/s1 |
| InChIKey | LLYYNOVSVPBRGV-BILPJLMMSA-N |
| XLogP | 4.50 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.83 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|