C27H37NO5 — CID 10276034
[(2R,4S,6R,7R,9R,14R)-4-ethenyl-9-methoxy-2,4,7,14-tetramethyl-3-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 4-oxo-1H-pyridine-3-carboxylate (PubChem CID 10276034) has the molecular formula C27H37NO5 and a molecular weight of 455.60 g/mol. Its IUPAC name is [(2R,4S,6R,7R,9R,14R)-4-ethenyl-9-methoxy-2,4,7,14-tetramethyl-3-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 4-oxo-1H-pyridine-3-carboxylate.
| Compound Name | [(2R,4S,6R,7R,9R,14R)-4-ethenyl-9-methoxy-2,4,7,14-tetramethyl-3-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 4-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 10276034 |
| Molecular Formula | C27H37NO5 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | [(2R,4S,6R,7R,9R,14R)-4-ethenyl-9-methoxy-2,4,7,14-tetramethyl-3-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 4-oxo-1H-pyridine-3-carboxylate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)c2c[nH]ccc2=O)[C@@]2(C)C3C(OC)CCC3(CC[C@H]2C)[C@@H](C)C1=O |
| InChI | InChI=1S/C27H37NO5/c1-7-25(4)14-21(33-24(31)18-15-28-13-10-19(18)29)26(5)16(2)8-11-27(17(3)23(25)30)12-9-20(32-6)22(26)27/h7,10,13,15-17,20-22H,1,8-9,11-12,14H2,2-6H3,(H,28,29)/t16-,17+,20?,21-,22?,25-,26+,27?/m1/s1 |
| InChIKey | QUJJCOBHGSKOOR-SUMCLMJDSA-N |
| XLogP | 4.55 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|