C31H42BFO7 — CID 175773955
2-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-2-[(1R,2R,4R,6R,7R,8S,9R,14R)-9-methoxy-2,4,7,14-tetramethyl-3-oxo-4-prop-2-enyl-6-tricyclo[5.4.3.01,8]tetradecanyl]acetic acid (PubChem CID 175773955) has the molecular formula C31H42BFO7 and a molecular weight of 556.48 g/mol. Its IUPAC name is 2-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-2-[(1R,2R,4R,6R,7R,8S,9R,14R)-9-methoxy-2,4,7,14-tetramethyl-3-oxo-4-prop-2-enyl-6-tricyclo[5.4.3.01,8]tetradecanyl]acetic acid.
| Compound Name | 2-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-2-[(1R,2R,4R,6R,7R,8S,9R,14R)-9-methoxy-2,4,7,14-tetramethyl-3-oxo-4-prop-2-enyl-6-tricyclo[5.4.3.01,8]tetradecanyl]acetic acid |
|---|---|
| PubChem CID | 175773955 |
| Molecular Formula | C31H42BFO7 |
| Molecular Weight | 556.48 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | 2-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-2-[(1R,2R,4R,6R,7R,8S,9R,14R)-9-methoxy-2,4,7,14-tetramethyl-3-oxo-4-prop-2-enyl-6-tricyclo[5.4.3.01,8]tetradecanyl]acetic acid |
| SMILES | C=CC[C@]1(C)C[C@@H](C(Oc2ccc3c(c2F)B(O)OC3)C(=O)O)[C@@]2(C)[C@H](C)CC[C@]3(CC[C@@H](OC)[C@@H]32)[C@@H](C)C1=O |
| InChI | InChI=1S/C31H42BFO7/c1-7-12-29(4)15-20(25(28(35)36)40-21-9-8-19-16-39-32(37)23(19)24(21)33)30(5)17(2)10-13-31(18(3)27(29)34)14-11-22(38-6)26(30)31/h7-9,17-18,20,22,25-26,37H,1,10-16H2,2-6H3,(H,35,36)/t17-,18+,20+,22-,25?,26-,29-,30-,31+/m1/s1 |
| InChIKey | GXVCPPRIVBBSPH-AENFLJKRSA-N |
| XLogP | 4.53 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|