C23H38F2O5 — CID 88594532
(2R,4R,6R,7R,9R,14R)-4-(2,2-difluoroethoxy)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one (PubChem CID 88594532) has the molecular formula C23H38F2O5 and a molecular weight of 432.55 g/mol. Its IUPAC name is (2R,4R,6R,7R,9R,14R)-4-(2,2-difluoroethoxy)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one.
| Compound Name | (2R,4R,6R,7R,9R,14R)-4-(2,2-difluoroethoxy)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one |
|---|---|
| PubChem CID | 88594532 |
| Molecular Formula | C23H38F2O5 |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | (2R,4R,6R,7R,9R,14R)-4-(2,2-difluoroethoxy)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one |
| SMILES | COCO[C@@H]1C[C@@](C)(OCC(F)F)C(=O)[C@H](C)C23CCC(OC)C2[C@@]1(C)[C@H](C)CC3 |
| InChI | InChI=1S/C23H38F2O5/c1-14-7-9-23-10-8-16(28-6)19(23)22(14,4)17(29-13-27-5)11-21(3,20(26)15(23)2)30-12-18(24)25/h14-19H,7-13H2,1-6H3/t14-,15+,16?,17-,19?,21-,22+,23?/m1/s1 |
| InChIKey | PMRFUBSOXRIXOK-AMFIXFJZSA-N |
| XLogP | 4.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|