C30H58O5Si2 — CID 102362432
(5R,7R)-2'-[tert-butyl(dimethyl)silyl]oxy-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-hydroxy-3',3'-dimethylspiro[4a,5,6,7,8,8a-hexahydro-3H-isochromene-4,1'-cyclohexane]-1-one (PubChem CID 102362432) has the molecular formula C30H58O5Si2 and a molecular weight of 554.96 g/mol. Its IUPAC name is (5R,7R)-2'-[tert-butyl(dimethyl)silyl]oxy-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-hydroxy-3',3'-dimethylspiro[4a,5,6,7,8,8a-hexahydro-3H-isochromene-4,1'-cyclohexane]-1-one.
| Compound Name | (5R,7R)-2'-[tert-butyl(dimethyl)silyl]oxy-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-hydroxy-3',3'-dimethylspiro[4a,5,6,7,8,8a-hexahydro-3H-isochromene-4,1'-cyclohexane]-1-one |
|---|---|
| PubChem CID | 102362432 |
| Molecular Formula | C30H58O5Si2 |
| Molecular Weight | 554.96 g/mol |
| Exact Mass | 554.38 |
| IUPAC Name | (5R,7R)-2'-[tert-butyl(dimethyl)silyl]oxy-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-hydroxy-3',3'-dimethylspiro[4a,5,6,7,8,8a-hexahydro-3H-isochromene-4,1'-cyclohexane]-1-one |
| SMILES | CC1(C)CCCC2(COC(=O)C3C[C@H](CCO[Si](C)(C)C(C)(C)C)CC(O)C32)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H58O5Si2/c1-27(2,3)36(9,10)34-17-14-21-18-22-24(23(31)19-21)30(20-33-25(22)32)16-13-15-29(7,8)26(30)35-37(11,12)28(4,5)6/h21-24,26,31H,13-20H2,1-12H3/t21-,22?,23?,24?,26?,30?/m0/s1 |
| InChIKey | GRHKGWNBMUXGBG-WGMXUADASA-N |
| XLogP | 7.55 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.96 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|