C21H40O4Si — CID 10643760
(1R,4R,4aS,8aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(hydroxymethyl)-4a,8,8-trimethyl-5,6,7,8a-tetrahydro-1H-naphthalene-1,4-diol (PubChem CID 10643760) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is (1R,4R,4aS,8aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(hydroxymethyl)-4a,8,8-trimethyl-5,6,7,8a-tetrahydro-1H-naphthalene-1,4-diol.
| Compound Name | (1R,4R,4aS,8aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(hydroxymethyl)-4a,8,8-trimethyl-5,6,7,8a-tetrahydro-1H-naphthalene-1,4-diol |
|---|---|
| PubChem CID | 10643760 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | (1R,4R,4aS,8aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(hydroxymethyl)-4a,8,8-trimethyl-5,6,7,8a-tetrahydro-1H-naphthalene-1,4-diol |
| SMILES | CC1(C)CCC[C@@]2(C)[C@H]1[C@H](O)C=C(CO[Si](C)(C)C(C)(C)C)[C@@]2(O)CO |
| InChI | InChI=1S/C21H40O4Si/c1-18(2,3)26(7,8)25-13-15-12-16(23)17-19(4,5)10-9-11-20(17,6)21(15,24)14-22/h12,16-17,22-24H,9-11,13-14H2,1-8H3/t16-,17+,20+,21+/m1/s1 |
| InChIKey | OBMYEXWTTQAQPH-SEONNTABSA-N |
| XLogP | 3.87 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|