C21H32O7 — CID 132575869
methyl 2-[(1S,4S,8aS)-4-acetyloxy-2-(acetyloxymethyl)-1-hydroxy-5,5,8a-trimethyl-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl]acetate (PubChem CID 132575869) has the molecular formula C21H32O7 and a molecular weight of 396.48 g/mol. Its IUPAC name is methyl 2-[(1S,4S,8aS)-4-acetyloxy-2-(acetyloxymethyl)-1-hydroxy-5,5,8a-trimethyl-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl]acetate.
| Compound Name | methyl 2-[(1S,4S,8aS)-4-acetyloxy-2-(acetyloxymethyl)-1-hydroxy-5,5,8a-trimethyl-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl]acetate |
|---|---|
| PubChem CID | 132575869 |
| Molecular Formula | C21H32O7 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | methyl 2-[(1S,4S,8aS)-4-acetyloxy-2-(acetyloxymethyl)-1-hydroxy-5,5,8a-trimethyl-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl]acetate |
| SMILES | COC(=O)C[C@@]1(O)C(COC(C)=O)=C[C@H](OC(C)=O)C2C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C21H32O7/c1-13(22)27-12-15-10-16(28-14(2)23)18-19(3,4)8-7-9-20(18,5)21(15,25)11-17(24)26-6/h10,16,18,25H,7-9,11-12H2,1-6H3/t16-,18?,20-,21+/m0/s1 |
| InChIKey | AGIZYABLNYTRJQ-UPRUFMODSA-N |
| XLogP | 2.55 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|