C19H31BO5 — CID 14489298
[(1'R,4S,4'aS,8'aS)-2-ethyl-3'-(hydroxymethyl)-4'a,8',8'-trimethylspiro[1,3,2-dioxaborolane-4,4'-5,6,7,8a-tetrahydro-1H-naphthalene]-1'-yl] acetate (PubChem CID 14489298) has the molecular formula C19H31BO5 and a molecular weight of 350.26 g/mol. Its IUPAC name is [(1'R,4S,4'aS,8'aS)-2-ethyl-3'-(hydroxymethyl)-4'a,8',8'-trimethylspiro[1,3,2-dioxaborolane-4,4'-5,6,7,8a-tetrahydro-1H-naphthalene]-1'-yl] acetate.
| Compound Name | [(1'R,4S,4'aS,8'aS)-2-ethyl-3'-(hydroxymethyl)-4'a,8',8'-trimethylspiro[1,3,2-dioxaborolane-4,4'-5,6,7,8a-tetrahydro-1H-naphthalene]-1'-yl] acetate |
|---|---|
| PubChem CID | 14489298 |
| Molecular Formula | C19H31BO5 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | [(1'R,4S,4'aS,8'aS)-2-ethyl-3'-(hydroxymethyl)-4'a,8',8'-trimethylspiro[1,3,2-dioxaborolane-4,4'-5,6,7,8a-tetrahydro-1H-naphthalene]-1'-yl] acetate |
| SMILES | CCB1OC[C@@]2(O1)C(CO)=C[C@@H](OC(C)=O)[C@H]1C(C)(C)CCC[C@@]12C |
| InChI | InChI=1S/C19H31BO5/c1-6-20-23-12-19(25-20)14(11-21)10-15(24-13(2)22)16-17(3,4)8-7-9-18(16,19)5/h10,15-16,21H,6-9,11-12H2,1-5H3/t15-,16+,18+,19-/m1/s1 |
| InChIKey | IAVRGGJKXNKYKQ-KCITZHQASA-N |
| XLogP | 2.98 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|