C17H24O6 — CID 16739250
[(1R,5R,5aS,9aS,9bS)-1,9b-dihydroxy-6,6,9a-trimethyl-3-oxo-1,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-yl] acetate (PubChem CID 16739250) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is [(1R,5R,5aS,9aS,9bS)-1,9b-dihydroxy-6,6,9a-trimethyl-3-oxo-1,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-yl] acetate.
| Compound Name | [(1R,5R,5aS,9aS,9bS)-1,9b-dihydroxy-6,6,9a-trimethyl-3-oxo-1,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-yl] acetate |
|---|---|
| PubChem CID | 16739250 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | [(1R,5R,5aS,9aS,9bS)-1,9b-dihydroxy-6,6,9a-trimethyl-3-oxo-1,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C2C(=O)O[C@@H](O)[C@]2(O)[C@@]2(C)CCCC(C)(C)[C@H]12 |
| InChI | InChI=1S/C17H24O6/c1-9(18)22-11-8-10-13(19)23-14(20)17(10,21)16(4)7-5-6-15(2,3)12(11)16/h8,11-12,14,20-21H,5-7H2,1-4H3/t11-,12+,14-,16+,17+/m1/s1 |
| InChIKey | AXYROLCKVUMFEF-ZMNIPVBYSA-N |
| XLogP | 1.30 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |