C17H26O6 — CID 162977848
(1,7,9b-trihydroxy-6,6,9a-trimethyl-3,5,5a,7,8,9-hexahydro-1H-benzo[e][2]benzofuran-5-yl) acetate (PubChem CID 162977848) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is (1,7,9b-trihydroxy-6,6,9a-trimethyl-3,5,5a,7,8,9-hexahydro-1H-benzo[e][2]benzofuran-5-yl) acetate.
| Compound Name | (1,7,9b-trihydroxy-6,6,9a-trimethyl-3,5,5a,7,8,9-hexahydro-1H-benzo[e][2]benzofuran-5-yl) acetate |
|---|---|
| PubChem CID | 162977848 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (1,7,9b-trihydroxy-6,6,9a-trimethyl-3,5,5a,7,8,9-hexahydro-1H-benzo[e][2]benzofuran-5-yl) acetate |
| SMILES | CC(=O)OC1C=C2COC(O)C2(O)C2(C)CCC(O)C(C)(C)C12 |
| InChI | InChI=1S/C17H26O6/c1-9(18)23-11-7-10-8-22-14(20)17(10,21)16(4)6-5-12(19)15(2,3)13(11)16/h7,11-14,19-21H,5-6,8H2,1-4H3 |
| InChIKey | CUPLMGKGSLIRNY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|