C22H34O6 — CID 72752669
(2,6,11,15-tetrahydroxy-5,5,9-trimethyl-14-methylidene-3-tetracyclo[11.2.1.01,10.04,9]hexadecanyl) acetate (PubChem CID 72752669) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is (2,6,11,15-tetrahydroxy-5,5,9-trimethyl-14-methylidene-3-tetracyclo[11.2.1.01,10.04,9]hexadecanyl) acetate.
| Compound Name | (2,6,11,15-tetrahydroxy-5,5,9-trimethyl-14-methylidene-3-tetracyclo[11.2.1.01,10.04,9]hexadecanyl) acetate |
|---|---|
| PubChem CID | 72752669 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (2,6,11,15-tetrahydroxy-5,5,9-trimethyl-14-methylidene-3-tetracyclo[11.2.1.01,10.04,9]hexadecanyl) acetate |
| SMILES | C=C1C2CC(O)C3C4(C)CCC(O)C(C)(C)C4C(OC(C)=O)C(O)C3(C2)C1O |
| InChI | InChI=1S/C22H34O6/c1-10-12-8-13(24)16-21(5)7-6-14(25)20(3,4)17(21)15(28-11(2)23)19(27)22(16,9-12)18(10)26/h12-19,24-27H,1,6-9H2,2-5H3 |
| InChIKey | LUIISUPYQATGOA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|